C21H21ClN4O4S — CID 55340875
2-chloro-N-[1-[2-[2-(2-cyanophenoxy)acetyl]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide (PubChem CID 55340875) has the molecular formula C21H21ClN4O4S and a molecular weight of 460.94 g/mol. Its IUPAC name is 2-chloro-N-[1-[2-[2-(2-cyanophenoxy)acetyl]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[1-[2-[2-(2-cyanophenoxy)acetyl]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 55340875 |
| Molecular Formula | C21H21ClN4O4S |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 2-chloro-N-[1-[2-[2-(2-cyanophenoxy)acetyl]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]benzamide |
| SMILES | CSCCC(NC(=O)c1ccccc1Cl)C(=O)NNC(=O)COc1ccccc1C#N |
| InChI | InChI=1S/C21H21ClN4O4S/c1-31-11-10-17(24-20(28)15-7-3-4-8-16(15)22)21(29)26-25-19(27)13-30-18-9-5-2-6-14(18)12-23/h2-9,17H,10-11,13H2,1H3,(H,24,28)(H,25,27)(H,26,29) |
| InChIKey | RYGBDXJEZZLSAS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|