C20H24N4O4S — CID 9470460
[(2R)-4-methylsulfanyl-1-oxo-1-[2-[2-(2-phenylphenoxy)acetyl]hydrazinyl]butan-2-yl]urea (PubChem CID 9470460) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is [(2R)-4-methylsulfanyl-1-oxo-1-[2-[2-(2-phenylphenoxy)acetyl]hydrazinyl]butan-2-yl]urea.
| Compound Name | [(2R)-4-methylsulfanyl-1-oxo-1-[2-[2-(2-phenylphenoxy)acetyl]hydrazinyl]butan-2-yl]urea |
|---|---|
| PubChem CID | 9470460 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | [(2R)-4-methylsulfanyl-1-oxo-1-[2-[2-(2-phenylphenoxy)acetyl]hydrazinyl]butan-2-yl]urea |
| SMILES | CSCC[C@@H](NC(N)=O)C(=O)NNC(=O)COc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C20H24N4O4S/c1-29-12-11-16(22-20(21)27)19(26)24-23-18(25)13-28-17-10-6-5-9-15(17)14-7-3-2-4-8-14/h2-10,16H,11-13H2,1H3,(H,23,25)(H,24,26)(H3,21,22,27)/t16-/m1/s1 |
| InChIKey | AHRLRINZPUCDEF-MRXNPFEDSA-N |
| XLogP | 1.67 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|