C13H17FN4O3S — CID 9402593
[(2S)-1-[2-(2-fluorobenzoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]urea (PubChem CID 9402593) has the molecular formula C13H17FN4O3S and a molecular weight of 328.37 g/mol. Its IUPAC name is [(2S)-1-[2-(2-fluorobenzoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]urea.
| Compound Name | [(2S)-1-[2-(2-fluorobenzoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 9402593 |
| Molecular Formula | C13H17FN4O3S |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | [(2S)-1-[2-(2-fluorobenzoyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]urea |
| SMILES | CSCC[C@H](NC(N)=O)C(=O)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C13H17FN4O3S/c1-22-7-6-10(16-13(15)21)12(20)18-17-11(19)8-4-2-3-5-9(8)14/h2-5,10H,6-7H2,1H3,(H,17,19)(H,18,20)(H3,15,16,21)/t10-/m0/s1 |
| InChIKey | HXVHDUKGMVGWFB-JTQLQIEISA-N |
| XLogP | 0.38 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|