C10H10ClFN2O2 — CID 97300264
N'-[(2S)-2-chloropropanoyl]-2-fluorobenzohydrazide (PubChem CID 97300264) has the molecular formula C10H10ClFN2O2 and a molecular weight of 244.65 g/mol. Its IUPAC name is N'-[(2S)-2-chloropropanoyl]-2-fluorobenzohydrazide.
| Compound Name | N'-[(2S)-2-chloropropanoyl]-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 97300264 |
| Molecular Formula | C10H10ClFN2O2 |
| Molecular Weight | 244.65 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | N'-[(2S)-2-chloropropanoyl]-2-fluorobenzohydrazide |
| SMILES | C[C@H](Cl)C(=O)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C10H10ClFN2O2/c1-6(11)9(15)13-14-10(16)7-4-2-3-5-8(7)12/h2-6H,1H3,(H,13,15)(H,14,16)/t6-/m0/s1 |
| InChIKey | RVACGMVKMPLCPD-LURJTMIESA-N |
| XLogP | 1.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.65 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|