C17H15FN4O2S — CID 41248411
N'-[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]-2-fluorobenzohydrazide (PubChem CID 41248411) has the molecular formula C17H15FN4O2S and a molecular weight of 358.40 g/mol. Its IUPAC name is N'-[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]-2-fluorobenzohydrazide.
| Compound Name | N'-[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 41248411 |
| Molecular Formula | C17H15FN4O2S |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | N'-[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]-2-fluorobenzohydrazide |
| SMILES | C[C@H](Nc1nc2ccccc2s1)C(=O)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C17H15FN4O2S/c1-10(19-17-20-13-8-4-5-9-14(13)25-17)15(23)21-22-16(24)11-6-2-3-7-12(11)18/h2-10H,1H3,(H,19,20)(H,21,23)(H,22,24)/t10-/m0/s1 |
| InChIKey | AVBGCCFGSGFVSX-JTQLQIEISA-N |
| XLogP | 2.70 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|