C21H24FN3O3 — CID 9402546
N-[(2R)-1-[2-(2-fluorobenzoyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide (PubChem CID 9402546) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is N-[(2R)-1-[2-(2-fluorobenzoyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide.
| Compound Name | N-[(2R)-1-[2-(2-fluorobenzoyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 9402546 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-[(2R)-1-[2-(2-fluorobenzoyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N[C@H](CC(C)C)C(=O)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C21H24FN3O3/c1-13(2)12-18(23-19(26)15-9-5-4-8-14(15)3)21(28)25-24-20(27)16-10-6-7-11-17(16)22/h4-11,13,18H,12H2,1-3H3,(H,23,26)(H,24,27)(H,25,28)/t18-/m1/s1 |
| InChIKey | RSHGAPBMZSNSGX-GOSISDBHSA-N |
| XLogP | 2.74 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|