C18H26N2O4 — CID 97072625
(3S)-3-[[(2S)-4-methyl-2-[(2-methylbenzoyl)amino]pentanoyl]amino]butanoic acid (PubChem CID 97072625) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is (3S)-3-[[(2S)-4-methyl-2-[(2-methylbenzoyl)amino]pentanoyl]amino]butanoic acid.
| Compound Name | (3S)-3-[[(2S)-4-methyl-2-[(2-methylbenzoyl)amino]pentanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 97072625 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (3S)-3-[[(2S)-4-methyl-2-[(2-methylbenzoyl)amino]pentanoyl]amino]butanoic acid |
| SMILES | Cc1ccccc1C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)CC(=O)O |
| InChI | InChI=1S/C18H26N2O4/c1-11(2)9-15(18(24)19-13(4)10-16(21)22)20-17(23)14-8-6-5-7-12(14)3/h5-8,11,13,15H,9-10H2,1-4H3,(H,19,24)(H,20,23)(H,21,22)/t13-,15-/m0/s1 |
| InChIKey | KVOZWSMUAGOGDG-ZFWWWQNUSA-N |
| XLogP | 2.12 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |