C20H33N3O2 — CID 119667424
N-[1-(1-aminohexan-2-ylamino)-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide (PubChem CID 119667424) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is N-[1-(1-aminohexan-2-ylamino)-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide.
| Compound Name | N-[1-(1-aminohexan-2-ylamino)-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 119667424 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | N-[1-(1-aminohexan-2-ylamino)-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide |
| SMILES | CCCCC(CN)NC(=O)C(CC(C)C)NC(=O)c1ccccc1C |
| InChI | InChI=1S/C20H33N3O2/c1-5-6-10-16(13-21)22-20(25)18(12-14(2)3)23-19(24)17-11-8-7-9-15(17)4/h7-9,11,14,16,18H,5-6,10,12-13,21H2,1-4H3,(H,22,25)(H,23,24) |
| InChIKey | OJGGQLNJKTXDIK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |