C23H24ClN3O3S — CID 3909200
N-[1-[2-(3-chloro-1-benzothiophene-2-carbonyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide (PubChem CID 3909200) has the molecular formula C23H24ClN3O3S and a molecular weight of 457.98 g/mol. Its IUPAC name is N-[1-[2-(3-chloro-1-benzothiophene-2-carbonyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide.
| Compound Name | N-[1-[2-(3-chloro-1-benzothiophene-2-carbonyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 3909200 |
| Molecular Formula | C23H24ClN3O3S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | N-[1-[2-(3-chloro-1-benzothiophene-2-carbonyl)hydrazinyl]-4-methyl-1-oxopentan-2-yl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NC(CC(C)C)C(=O)NNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C23H24ClN3O3S/c1-13(2)12-17(25-21(28)15-9-5-4-8-14(15)3)22(29)26-27-23(30)20-19(24)16-10-6-7-11-18(16)31-20/h4-11,13,17H,12H2,1-3H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | GWAJDVCWWVVOSW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|