C23H31N5O4S — CID 46798212
2-methyl-N-[4-methyl-1-[2-(4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbonyl)hydrazinyl]-1-oxopentan-2-yl]benzamide (PubChem CID 46798212) has the molecular formula C23H31N5O4S and a molecular weight of 473.60 g/mol. Its IUPAC name is 2-methyl-N-[4-methyl-1-[2-(4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbonyl)hydrazinyl]-1-oxopentan-2-yl]benzamide.
| Compound Name | 2-methyl-N-[4-methyl-1-[2-(4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbonyl)hydrazinyl]-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 46798212 |
| Molecular Formula | C23H31N5O4S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 2-methyl-N-[4-methyl-1-[2-(4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbonyl)hydrazinyl]-1-oxopentan-2-yl]benzamide |
| SMILES | Cc1ccccc1C(=O)NC(CC(C)C)C(=O)NNC(=O)c1sc(N2CCOCC2)nc1C |
| InChI | InChI=1S/C23H31N5O4S/c1-14(2)13-18(25-20(29)17-8-6-5-7-15(17)3)21(30)26-27-22(31)19-16(4)24-23(33-19)28-9-11-32-12-10-28/h5-8,14,18H,9-13H2,1-4H3,(H,25,29)(H,26,30)(H,27,31) |
| InChIKey | NRQYVVUXYKIDBR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|