C21H28N4O4S — CID 55821686
4-methyl-2-morpholin-4-yl-N'-[2-(3-propan-2-ylphenoxy)propanoyl]-1,3-thiazole-5-carbohydrazide (PubChem CID 55821686) has the molecular formula C21H28N4O4S and a molecular weight of 432.55 g/mol. Its IUPAC name is 4-methyl-2-morpholin-4-yl-N'-[2-(3-propan-2-ylphenoxy)propanoyl]-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-2-morpholin-4-yl-N'-[2-(3-propan-2-ylphenoxy)propanoyl]-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 55821686 |
| Molecular Formula | C21H28N4O4S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 4-methyl-2-morpholin-4-yl-N'-[2-(3-propan-2-ylphenoxy)propanoyl]-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(N2CCOCC2)sc1C(=O)NNC(=O)C(C)Oc1cccc(C(C)C)c1 |
| InChI | InChI=1S/C21H28N4O4S/c1-13(2)16-6-5-7-17(12-16)29-15(4)19(26)23-24-20(27)18-14(3)22-21(30-18)25-8-10-28-11-9-25/h5-7,12-13,15H,8-11H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | JVNDDSKRNHTWFV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|