C19H19ClN4O3S2 — CID 30689371
N'-(3-chloro-4-methyl-1-benzothiophene-2-carbonyl)-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 30689371) has the molecular formula C19H19ClN4O3S2 and a molecular weight of 450.97 g/mol. Its IUPAC name is N'-(3-chloro-4-methyl-1-benzothiophene-2-carbonyl)-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-(3-chloro-4-methyl-1-benzothiophene-2-carbonyl)-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 30689371 |
| Molecular Formula | C19H19ClN4O3S2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | N'-(3-chloro-4-methyl-1-benzothiophene-2-carbonyl)-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(N2CCOCC2)sc1C(=O)NNC(=O)c1sc2cccc(C)c2c1Cl |
| InChI | InChI=1S/C19H19ClN4O3S2/c1-10-4-3-5-12-13(10)14(20)16(28-12)18(26)23-22-17(25)15-11(2)21-19(29-15)24-6-8-27-9-7-24/h3-5H,6-9H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | LIVSZZHCIACMNL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|