C18H17ClN4O3S2 — CID 25446089
N'-(3-chloro-1-benzothiophene-2-carbonyl)-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 25446089) has the molecular formula C18H17ClN4O3S2 and a molecular weight of 436.95 g/mol. Its IUPAC name is N'-(3-chloro-1-benzothiophene-2-carbonyl)-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-(3-chloro-1-benzothiophene-2-carbonyl)-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 25446089 |
| Molecular Formula | C18H17ClN4O3S2 |
| Molecular Weight | 436.95 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | N'-(3-chloro-1-benzothiophene-2-carbonyl)-4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(N2CCOCC2)sc1C(=O)NNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C18H17ClN4O3S2/c1-10-14(28-18(20-10)23-6-8-26-9-7-23)16(24)21-22-17(25)15-13(19)11-4-2-3-5-12(11)27-15/h2-5H,6-9H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | GTQGHWIXPXUTOG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.95 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|