C19H24N4O4S — CID 43004097
4-methyl-N'-[2-(3-methylphenoxy)propanoyl]-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 43004097) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is 4-methyl-N'-[2-(3-methylphenoxy)propanoyl]-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 4-methyl-N'-[2-(3-methylphenoxy)propanoyl]-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 43004097 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-methyl-N'-[2-(3-methylphenoxy)propanoyl]-2-morpholin-4-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1cccc(OC(C)C(=O)NNC(=O)c2sc(N3CCOCC3)nc2C)c1 |
| InChI | InChI=1S/C19H24N4O4S/c1-12-5-4-6-15(11-12)27-14(3)17(24)21-22-18(25)16-13(2)20-19(28-16)23-7-9-26-10-8-23/h4-6,11,14H,7-10H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | VLPPOEUWYHOZNZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|