C20H19ClN2O3S — CID 4932040
3-chloro-N'-[2-(2-methylphenoxy)butanoyl]-1-benzothiophene-2-carbohydrazide (PubChem CID 4932040) has the molecular formula C20H19ClN2O3S and a molecular weight of 402.90 g/mol. Its IUPAC name is 3-chloro-N'-[2-(2-methylphenoxy)butanoyl]-1-benzothiophene-2-carbohydrazide.
| Compound Name | 3-chloro-N'-[2-(2-methylphenoxy)butanoyl]-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 4932040 |
| Molecular Formula | C20H19ClN2O3S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 3-chloro-N'-[2-(2-methylphenoxy)butanoyl]-1-benzothiophene-2-carbohydrazide |
| SMILES | CCC(Oc1ccccc1C)C(=O)NNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C20H19ClN2O3S/c1-3-14(26-15-10-6-4-8-12(15)2)19(24)22-23-20(25)18-17(21)13-9-5-7-11-16(13)27-18/h4-11,14H,3H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | UKLTWYDBLQLGQP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|