C14H19ClN4O3S2 — CID 8892802
[(2S)-1-[2-[2-(4-chlorophenyl)sulfanylacetyl]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]urea (PubChem CID 8892802) has the molecular formula C14H19ClN4O3S2 and a molecular weight of 390.92 g/mol. Its IUPAC name is [(2S)-1-[2-[2-(4-chlorophenyl)sulfanylacetyl]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]urea.
| Compound Name | [(2S)-1-[2-[2-(4-chlorophenyl)sulfanylacetyl]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 8892802 |
| Molecular Formula | C14H19ClN4O3S2 |
| Molecular Weight | 390.92 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | [(2S)-1-[2-[2-(4-chlorophenyl)sulfanylacetyl]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]urea |
| SMILES | CSCC[C@H](NC(N)=O)C(=O)NNC(=O)CSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H19ClN4O3S2/c1-23-7-6-11(17-14(16)22)13(21)19-18-12(20)8-24-10-4-2-9(15)3-5-10/h2-5,11H,6-8H2,1H3,(H,18,20)(H,19,21)(H3,16,17,22)/t11-/m0/s1 |
| InChIKey | OMNRWYVNAWXOQA-NSHDSACASA-N |
| XLogP | 1.37 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.92 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|