C20H21ClN2O4S — CID 7965942
methyl 4-[[(2S)-2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]amino]benzoate (PubChem CID 7965942) has the molecular formula C20H21ClN2O4S and a molecular weight of 420.92 g/mol. Its IUPAC name is methyl 4-[[(2S)-2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]amino]benzoate.
| Compound Name | methyl 4-[[(2S)-2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]amino]benzoate |
|---|---|
| PubChem CID | 7965942 |
| Molecular Formula | C20H21ClN2O4S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | methyl 4-[[(2S)-2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)[C@H](CCSC)NC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2O4S/c1-27-20(26)13-7-9-14(10-8-13)22-19(25)17(11-12-28-2)23-18(24)15-5-3-4-6-16(15)21/h3-10,17H,11-12H2,1-2H3,(H,22,25)(H,23,24)/t17-/m0/s1 |
| InChIKey | JALBJGMLXRSZPJ-KRWDZBQOSA-N |
| XLogP | 3.62 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |