C22H23ClN4O2S — CID 55971072
2-chloro-N-[4-methylsulfanyl-1-oxo-1-[4-(pyrazol-1-ylmethyl)anilino]butan-2-yl]benzamide (PubChem CID 55971072) has the molecular formula C22H23ClN4O2S and a molecular weight of 442.97 g/mol. Its IUPAC name is 2-chloro-N-[4-methylsulfanyl-1-oxo-1-[4-(pyrazol-1-ylmethyl)anilino]butan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[4-methylsulfanyl-1-oxo-1-[4-(pyrazol-1-ylmethyl)anilino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 55971072 |
| Molecular Formula | C22H23ClN4O2S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-chloro-N-[4-methylsulfanyl-1-oxo-1-[4-(pyrazol-1-ylmethyl)anilino]butan-2-yl]benzamide |
| SMILES | CSCCC(NC(=O)c1ccccc1Cl)C(=O)Nc1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C22H23ClN4O2S/c1-30-14-11-20(26-21(28)18-5-2-3-6-19(18)23)22(29)25-17-9-7-16(8-10-17)15-27-13-4-12-24-27/h2-10,12-13,20H,11,14-15H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | RKMCMZWTOZKINR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |