C23H26N4O3S — CID 55619442
4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]-N-[3-(pyrazol-1-ylmethyl)phenyl]butanamide (PubChem CID 55619442) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]-N-[3-(pyrazol-1-ylmethyl)phenyl]butanamide.
| Compound Name | 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]-N-[3-(pyrazol-1-ylmethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 55619442 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]-N-[3-(pyrazol-1-ylmethyl)phenyl]butanamide |
| SMILES | CSCCC(NC(=O)COc1ccccc1)C(=O)Nc1cccc(Cn2cccn2)c1 |
| InChI | InChI=1S/C23H26N4O3S/c1-31-14-11-21(26-22(28)17-30-20-9-3-2-4-10-20)23(29)25-19-8-5-7-18(15-19)16-27-13-6-12-24-27/h2-10,12-13,15,21H,11,14,16-17H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | ZBINAJFDWHNLFQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |