C20H21F3N2O3S — CID 34754046
(2R)-4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]-N-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 34754046) has the molecular formula C20H21F3N2O3S and a molecular weight of 426.46 g/mol. Its IUPAC name is (2R)-4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]-N-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | (2R)-4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]-N-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 34754046 |
| Molecular Formula | C20H21F3N2O3S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (2R)-4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]-N-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | CSCC[C@@H](NC(=O)COc1ccccc1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H21F3N2O3S/c1-29-11-10-17(25-18(26)13-28-16-8-3-2-4-9-16)19(27)24-15-7-5-6-14(12-15)20(21,22)23/h2-9,12,17H,10-11,13H2,1H3,(H,24,27)(H,25,26)/t17-/m1/s1 |
| InChIKey | OHROTIONZZEGSB-QGZVFWFLSA-N |
| XLogP | 3.96 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |