C21H24FN3O4S — CID 55551210
N-(5-acetamido-2-fluorophenyl)-4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanamide (PubChem CID 55551210) has the molecular formula C21H24FN3O4S and a molecular weight of 433.51 g/mol. Its IUPAC name is N-(5-acetamido-2-fluorophenyl)-4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanamide.
| Compound Name | N-(5-acetamido-2-fluorophenyl)-4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanamide |
|---|---|
| PubChem CID | 55551210 |
| Molecular Formula | C21H24FN3O4S |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | N-(5-acetamido-2-fluorophenyl)-4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanamide |
| SMILES | CSCCC(NC(=O)COc1ccccc1)C(=O)Nc1cc(NC(C)=O)ccc1F |
| InChI | InChI=1S/C21H24FN3O4S/c1-14(26)23-15-8-9-17(22)19(12-15)25-21(28)18(10-11-30-2)24-20(27)13-29-16-6-4-3-5-7-16/h3-9,12,18H,10-11,13H2,1-2H3,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | YHHCOUMGZDFKLS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |