C22H26N2O5S — CID 55339147
methyl 4-methyl-3-[[4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoyl]amino]benzoate (PubChem CID 55339147) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is methyl 4-methyl-3-[[4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoyl]amino]benzoate.
| Compound Name | methyl 4-methyl-3-[[4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoyl]amino]benzoate |
|---|---|
| PubChem CID | 55339147 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | methyl 4-methyl-3-[[4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)C(CCSC)NC(=O)COc2ccccc2)c1 |
| InChI | InChI=1S/C22H26N2O5S/c1-15-9-10-16(22(27)28-2)13-19(15)24-21(26)18(11-12-30-3)23-20(25)14-29-17-7-5-4-6-8-17/h4-10,13,18H,11-12,14H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | USVGOKXUERROFU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |