C16H24N2O5S2 — CID 51954584
(2S)-4-methylsulfanyl-N-(2-methylsulfonylethyl)-2-[(2-phenoxyacetyl)amino]butanamide (PubChem CID 51954584) has the molecular formula C16H24N2O5S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-N-(2-methylsulfonylethyl)-2-[(2-phenoxyacetyl)amino]butanamide.
| Compound Name | (2S)-4-methylsulfanyl-N-(2-methylsulfonylethyl)-2-[(2-phenoxyacetyl)amino]butanamide |
|---|---|
| PubChem CID | 51954584 |
| Molecular Formula | C16H24N2O5S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (2S)-4-methylsulfanyl-N-(2-methylsulfonylethyl)-2-[(2-phenoxyacetyl)amino]butanamide |
| SMILES | CSCC[C@H](NC(=O)COc1ccccc1)C(=O)NCCS(C)(=O)=O |
| InChI | InChI=1S/C16H24N2O5S2/c1-24-10-8-14(16(20)17-9-11-25(2,21)22)18-15(19)12-23-13-6-4-3-5-7-13/h3-7,14H,8-12H2,1-2H3,(H,17,20)(H,18,19)/t14-/m0/s1 |
| InChIKey | ZTQBUACYEQBQGK-AWEZNQCLSA-N |
| XLogP | 0.46 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |