C21H26N2O4S — CID 34146017
(2S)-N-[(3-methoxyphenyl)methyl]-4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanamide (PubChem CID 34146017) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is (2S)-N-[(3-methoxyphenyl)methyl]-4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanamide.
| Compound Name | (2S)-N-[(3-methoxyphenyl)methyl]-4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanamide |
|---|---|
| PubChem CID | 34146017 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (2S)-N-[(3-methoxyphenyl)methyl]-4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanamide |
| SMILES | COc1cccc(CNC(=O)[C@H](CCSC)NC(=O)COc2ccccc2)c1 |
| InChI | InChI=1S/C21H26N2O4S/c1-26-18-10-6-7-16(13-18)14-22-21(25)19(11-12-28-2)23-20(24)15-27-17-8-4-3-5-9-17/h3-10,13,19H,11-12,14-15H2,1-2H3,(H,22,25)(H,23,24)/t19-/m0/s1 |
| InChIKey | HWEJZPXLBOGVMX-IBGZPJMESA-N |
| XLogP | 2.63 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |