C21H26N2O3S — CID 55339372
N-[1-[(3-methoxyphenyl)methylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-3-methylbenzamide (PubChem CID 55339372) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-[1-[(3-methoxyphenyl)methylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-3-methylbenzamide.
| Compound Name | N-[1-[(3-methoxyphenyl)methylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 55339372 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | N-[1-[(3-methoxyphenyl)methylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-3-methylbenzamide |
| SMILES | COc1cccc(CNC(=O)C(CCSC)NC(=O)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C21H26N2O3S/c1-15-6-4-8-17(12-15)20(24)23-19(10-11-27-3)21(25)22-14-16-7-5-9-18(13-16)26-2/h4-9,12-13,19H,10-11,14H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | IIYWUWICEIRVIO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |