C23H23ClN4O4S3 — CID 98404054
methyl 4-[[5-[[(2R)-2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate (PubChem CID 98404054) has the molecular formula C23H23ClN4O4S3 and a molecular weight of 551.12 g/mol. Its IUPAC name is methyl 4-[[5-[[(2R)-2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[[5-[[(2R)-2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 98404054 |
| Molecular Formula | C23H23ClN4O4S3 |
| Molecular Weight | 551.12 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | methyl 4-[[5-[[(2R)-2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoyl]amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSc2nnc(NC(=O)[C@@H](CCSC)NC(=O)c3ccccc3Cl)s2)cc1 |
| InChI | InChI=1S/C23H23ClN4O4S3/c1-32-21(31)15-9-7-14(8-10-15)13-34-23-28-27-22(35-23)26-20(30)18(11-12-33-2)25-19(29)16-5-3-4-6-17(16)24/h3-10,18H,11-13H2,1-2H3,(H,25,29)(H,26,27,30)/t18-/m1/s1 |
| InChIKey | SIDWEQXYSVXXEQ-GOSISDBHSA-N |
| XLogP | 4.76 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.12 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|