C21H16N4O3S2 — CID 4816251
methyl 4-[[5-(quinoline-2-carbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate (PubChem CID 4816251) has the molecular formula C21H16N4O3S2 and a molecular weight of 436.52 g/mol. Its IUPAC name is methyl 4-[[5-(quinoline-2-carbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[[5-(quinoline-2-carbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 4816251 |
| Molecular Formula | C21H16N4O3S2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | methyl 4-[[5-(quinoline-2-carbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSc2nnc(NC(=O)c3ccc4ccccc4n3)s2)cc1 |
| InChI | InChI=1S/C21H16N4O3S2/c1-28-19(27)15-8-6-13(7-9-15)12-29-21-25-24-20(30-21)23-18(26)17-11-10-14-4-2-3-5-16(14)22-17/h2-11H,12H2,1H3,(H,23,24,26) |
| InChIKey | CFHAPYLNGHKYBV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|