C14H14N4O3S3 — CID 2412832
methyl 4-[[5-(acetylcarbamothioylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate (PubChem CID 2412832) has the molecular formula C14H14N4O3S3 and a molecular weight of 382.49 g/mol. Its IUPAC name is methyl 4-[[5-(acetylcarbamothioylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[[5-(acetylcarbamothioylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 2412832 |
| Molecular Formula | C14H14N4O3S3 |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | methyl 4-[[5-(acetylcarbamothioylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSc2nnc(NC(=S)NC(C)=O)s2)cc1 |
| InChI | InChI=1S/C14H14N4O3S3/c1-8(19)15-12(22)16-13-17-18-14(24-13)23-7-9-3-5-10(6-4-9)11(20)21-2/h3-6H,7H2,1-2H3,(H2,15,16,17,19,22) |
| InChIKey | SXZKRHZDKQKLCS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|