C18H16N4O3S3 — CID 4812455
methyl 4-[[5-[(2-methylsulfanylpyridine-3-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate (PubChem CID 4812455) has the molecular formula C18H16N4O3S3 and a molecular weight of 432.55 g/mol. Its IUPAC name is methyl 4-[[5-[(2-methylsulfanylpyridine-3-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[[5-[(2-methylsulfanylpyridine-3-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 4812455 |
| Molecular Formula | C18H16N4O3S3 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | methyl 4-[[5-[(2-methylsulfanylpyridine-3-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSc2nnc(NC(=O)c3cccnc3SC)s2)cc1 |
| InChI | InChI=1S/C18H16N4O3S3/c1-25-16(24)12-7-5-11(6-8-12)10-27-18-22-21-17(28-18)20-14(23)13-4-3-9-19-15(13)26-2/h3-9H,10H2,1-2H3,(H,20,21,23) |
| InChIKey | GHUWLTPUNOQXJG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|