C23H19N5O4S2 — CID 4661551
methyl 4-[[5-[(1-benzyl-6-oxopyridazine-3-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate (PubChem CID 4661551) has the molecular formula C23H19N5O4S2 and a molecular weight of 493.57 g/mol. Its IUPAC name is methyl 4-[[5-[(1-benzyl-6-oxopyridazine-3-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[[5-[(1-benzyl-6-oxopyridazine-3-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 4661551 |
| Molecular Formula | C23H19N5O4S2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | methyl 4-[[5-[(1-benzyl-6-oxopyridazine-3-carbonyl)amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSc2nnc(NC(=O)c3ccc(=O)n(Cc4ccccc4)n3)s2)cc1 |
| InChI | InChI=1S/C23H19N5O4S2/c1-32-21(31)17-9-7-16(8-10-17)14-33-23-26-25-22(34-23)24-20(30)18-11-12-19(29)28(27-18)13-15-5-3-2-4-6-15/h2-12H,13-14H2,1H3,(H,24,25,30) |
| InChIKey | GJAUYKJQLKGOAS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|