C20H20F3N3O3S — CID 135804219
N-[1-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-4-(trifluoromethyl)benzamide (PubChem CID 135804219) has the molecular formula C20H20F3N3O3S and a molecular weight of 439.46 g/mol. Its IUPAC name is N-[1-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[1-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 135804219 |
| Molecular Formula | C20H20F3N3O3S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N-[1-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-4-(trifluoromethyl)benzamide |
| SMILES | CSCCC(NC(=O)c1ccc(C(F)(F)F)cc1)C(=O)N/N=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C20H20F3N3O3S/c1-30-11-10-17(19(29)26-24-12-13-2-8-16(27)9-3-13)25-18(28)14-4-6-15(7-5-14)20(21,22)23/h2-9,12,17,27H,10-11H2,1H3,(H,25,28)(H,26,29)/b24-12+ |
| InChIKey | DAFXEBWXHWLMDL-WYMPLXKRSA-N |
| XLogP | 3.41 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|