C22H23BrF3N3O4S — CID 6733460
N-[1-[2-[(3-bromo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-4-(trifluoromethyl)benzamide (PubChem CID 6733460) has the molecular formula C22H23BrF3N3O4S and a molecular weight of 562.41 g/mol. Its IUPAC name is N-[1-[2-[(3-bromo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[1-[2-[(3-bromo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 6733460 |
| Molecular Formula | C22H23BrF3N3O4S |
| Molecular Weight | 562.41 g/mol |
| Exact Mass | 561.05 |
| IUPAC Name | N-[1-[2-[(3-bromo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-4-(trifluoromethyl)benzamide |
| SMILES | COc1cc(C=NNC(=O)C(CCSC)NC(=O)c2ccc(C(F)(F)F)cc2)cc(Br)c1OC |
| InChI | InChI=1S/C22H23BrF3N3O4S/c1-32-18-11-13(10-16(23)19(18)33-2)12-27-29-21(31)17(8-9-34-3)28-20(30)14-4-6-15(7-5-14)22(24,25)26/h4-7,10-12,17H,8-9H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | PKFTUHYWGRPPDY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|