C20H22BrN3O6 — CID 3946161
N-[2-[2-[(3-bromo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide (PubChem CID 3946161) has the molecular formula C20H22BrN3O6 and a molecular weight of 480.32 g/mol. Its IUPAC name is N-[2-[2-[(3-bromo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[2-[(3-bromo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 3946161 |
| Molecular Formula | C20H22BrN3O6 |
| Molecular Weight | 480.32 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | N-[2-[2-[(3-bromo-4,5-dimethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)NN=Cc2cc(Br)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C20H22BrN3O6/c1-27-15-6-5-13(9-16(15)28-2)20(26)22-11-18(25)24-23-10-12-7-14(21)19(30-4)17(8-12)29-3/h5-10H,11H2,1-4H3,(H,22,26)(H,24,25) |
| InChIKey | IUZZZNHQOBXZBW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|