C22H26IN3O6 — CID 4019616
N-[2-[2-[(3-iodo-5-methoxy-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide (PubChem CID 4019616) has the molecular formula C22H26IN3O6 and a molecular weight of 555.37 g/mol. Its IUPAC name is N-[2-[2-[(3-iodo-5-methoxy-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[2-[(3-iodo-5-methoxy-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 4019616 |
| Molecular Formula | C22H26IN3O6 |
| Molecular Weight | 555.37 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | N-[2-[2-[(3-iodo-5-methoxy-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)NN=Cc2cc(I)c(OC(C)C)c(OC)c2)cc1OC |
| InChI | InChI=1S/C22H26IN3O6/c1-13(2)32-21-16(23)8-14(9-19(21)31-5)11-25-26-20(27)12-24-22(28)15-6-7-17(29-3)18(10-15)30-4/h6-11,13H,12H2,1-5H3,(H,24,28)(H,26,27) |
| InChIKey | AKHLBMADLCGCEK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|