C27H27Br2N3O6 — CID 4995669
N-[2-[2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide (PubChem CID 4995669) has the molecular formula C27H27Br2N3O6 and a molecular weight of 649.34 g/mol. Its IUPAC name is N-[2-[2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 4995669 |
| Molecular Formula | C27H27Br2N3O6 |
| Molecular Weight | 649.34 g/mol |
| Exact Mass | 647.03 |
| IUPAC Name | N-[2-[2-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide |
| SMILES | CCOc1cc(C=NNC(=O)CNC(=O)c2ccc(OC)c(OC)c2)cc(Br)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C27H27Br2N3O6/c1-4-37-24-12-18(11-21(29)26(24)38-16-17-5-8-20(28)9-6-17)14-31-32-25(33)15-30-27(34)19-7-10-22(35-2)23(13-19)36-3/h5-14H,4,15-16H2,1-3H3,(H,30,34)(H,32,33) |
| InChIKey | OCUOBISWLKEOOQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.34 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|