C22H26BrN3O5 — CID 6092100
N-[2-[(2Z)-2-[(3-bromo-4-butoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide (PubChem CID 6092100) has the molecular formula C22H26BrN3O5 and a molecular weight of 492.37 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[(3-bromo-4-butoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[(2Z)-2-[(3-bromo-4-butoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 6092100 |
| Molecular Formula | C22H26BrN3O5 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | N-[2-[(2Z)-2-[(3-bromo-4-butoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-3,4-dimethoxybenzamide |
| SMILES | CCCCOc1ccc(/C=N\NC(=O)CNC(=O)c2ccc(OC)c(OC)c2)cc1Br |
| InChI | InChI=1S/C22H26BrN3O5/c1-4-5-10-31-18-8-6-15(11-17(18)23)13-25-26-21(27)14-24-22(28)16-7-9-19(29-2)20(12-16)30-3/h6-9,11-13H,4-5,10,14H2,1-3H3,(H,24,28)(H,26,27)/b25-13- |
| InChIKey | FFFMRDGAJDFMLR-MXAYSNPKSA-N |
| XLogP | 3.53 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|