C23H30N4O3S — CID 20699649
4-methylsulfanyl-2-[[2-phenyl-4-(piperazin-2-ylmethylamino)benzoyl]amino]butanoic acid (PubChem CID 20699649) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is 4-methylsulfanyl-2-[[2-phenyl-4-(piperazin-2-ylmethylamino)benzoyl]amino]butanoic acid.
| Compound Name | 4-methylsulfanyl-2-[[2-phenyl-4-(piperazin-2-ylmethylamino)benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 20699649 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 4-methylsulfanyl-2-[[2-phenyl-4-(piperazin-2-ylmethylamino)benzoyl]amino]butanoic acid |
| SMILES | CSCCC(NC(=O)c1ccc(NCC2CNCCN2)cc1-c1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H30N4O3S/c1-31-12-9-21(23(29)30)27-22(28)19-8-7-17(26-15-18-14-24-10-11-25-18)13-20(19)16-5-3-2-4-6-16/h2-8,13,18,21,24-26H,9-12,14-15H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | RJHRFMSTYBTOAV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |