C24H29N3O4S — CID 91203512
(2S)-4-methylsulfanyl-2-[[2-phenyl-4-(piperidine-3-carbonylamino)benzoyl]amino]butanoic acid (PubChem CID 91203512) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-[[2-phenyl-4-(piperidine-3-carbonylamino)benzoyl]amino]butanoic acid.
| Compound Name | (2S)-4-methylsulfanyl-2-[[2-phenyl-4-(piperidine-3-carbonylamino)benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 91203512 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-[[2-phenyl-4-(piperidine-3-carbonylamino)benzoyl]amino]butanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1ccc(NC(=O)C2CCCNC2)cc1-c1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H29N3O4S/c1-32-13-11-21(24(30)31)27-23(29)19-10-9-18(14-20(19)16-6-3-2-4-7-16)26-22(28)17-8-5-12-25-15-17/h2-4,6-7,9-10,14,17,21,25H,5,8,11-13,15H2,1H3,(H,26,28)(H,27,29)(H,30,31)/t17?,21-/m0/s1 |
| InChIKey | AJNOGFVKGLCANM-LFABVHOISA-N |
| XLogP | 3.23 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |