C23H23N3O4S3 — CID 20623823
4-methylsulfanyl-2-[[2-phenyl-4-(pyridin-3-ylsulfanylsulfinylamino)benzoyl]amino]butanoic acid (PubChem CID 20623823) has the molecular formula C23H23N3O4S3 and a molecular weight of 501.66 g/mol. Its IUPAC name is 4-methylsulfanyl-2-[[2-phenyl-4-(pyridin-3-ylsulfanylsulfinylamino)benzoyl]amino]butanoic acid.
| Compound Name | 4-methylsulfanyl-2-[[2-phenyl-4-(pyridin-3-ylsulfanylsulfinylamino)benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 20623823 |
| Molecular Formula | C23H23N3O4S3 |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | 4-methylsulfanyl-2-[[2-phenyl-4-(pyridin-3-ylsulfanylsulfinylamino)benzoyl]amino]butanoic acid |
| SMILES | CSCCC(NC(=O)c1ccc(NS(=O)Sc2cccnc2)cc1-c1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H23N3O4S3/c1-31-13-11-21(23(28)29)25-22(27)19-10-9-17(14-20(19)16-6-3-2-4-7-16)26-33(30)32-18-8-5-12-24-15-18/h2-10,12,14-15,21,26H,11,13H2,1H3,(H,25,27)(H,28,29) |
| InChIKey | OINHVTMWQUDVMM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|