C26H28N2O3S — CID 23436154
methyl 4-methylsulfanyl-2-[[2-phenyl-4-(2-pyridin-3-ylethyl)benzoyl]amino]butanoate (PubChem CID 23436154) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is methyl 4-methylsulfanyl-2-[[2-phenyl-4-(2-pyridin-3-ylethyl)benzoyl]amino]butanoate.
| Compound Name | methyl 4-methylsulfanyl-2-[[2-phenyl-4-(2-pyridin-3-ylethyl)benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 23436154 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | methyl 4-methylsulfanyl-2-[[2-phenyl-4-(2-pyridin-3-ylethyl)benzoyl]amino]butanoate |
| SMILES | COC(=O)C(CCSC)NC(=O)c1ccc(CCc2cccnc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C26H28N2O3S/c1-31-26(30)24(14-16-32-2)28-25(29)22-13-12-19(10-11-20-7-6-15-27-18-20)17-23(22)21-8-4-3-5-9-21/h3-9,12-13,15,17-18,24H,10-11,14,16H2,1-2H3,(H,28,29) |
| InChIKey | UGJXOYAVMDBJCV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |