C25H27N3O3S — CID 23436495
methyl 4-methylsulfanyl-2-[[2-phenyl-4-[(pyridin-2-ylamino)methyl]benzoyl]amino]butanoate (PubChem CID 23436495) has the molecular formula C25H27N3O3S and a molecular weight of 449.58 g/mol. Its IUPAC name is methyl 4-methylsulfanyl-2-[[2-phenyl-4-[(pyridin-2-ylamino)methyl]benzoyl]amino]butanoate.
| Compound Name | methyl 4-methylsulfanyl-2-[[2-phenyl-4-[(pyridin-2-ylamino)methyl]benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 23436495 |
| Molecular Formula | C25H27N3O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | methyl 4-methylsulfanyl-2-[[2-phenyl-4-[(pyridin-2-ylamino)methyl]benzoyl]amino]butanoate |
| SMILES | COC(=O)C(CCSC)NC(=O)c1ccc(CNc2ccccn2)cc1-c1ccccc1 |
| InChI | InChI=1S/C25H27N3O3S/c1-31-25(30)22(13-15-32-2)28-24(29)20-12-11-18(17-27-23-10-6-7-14-26-23)16-21(20)19-8-4-3-5-9-19/h3-12,14,16,22H,13,15,17H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | UKVYPFCLYYHZNO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |