C22H23N3O4S4 — CID 20640664
methyl (2S)-4-methylsulfanyl-2-[[2-phenyl-4-(1,3-thiazol-2-ylsulfinamoylsulfanyl)benzoyl]amino]butanoate (PubChem CID 20640664) has the molecular formula C22H23N3O4S4 and a molecular weight of 521.71 g/mol. Its IUPAC name is methyl (2S)-4-methylsulfanyl-2-[[2-phenyl-4-(1,3-thiazol-2-ylsulfinamoylsulfanyl)benzoyl]amino]butanoate.
| Compound Name | methyl (2S)-4-methylsulfanyl-2-[[2-phenyl-4-(1,3-thiazol-2-ylsulfinamoylsulfanyl)benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 20640664 |
| Molecular Formula | C22H23N3O4S4 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | methyl (2S)-4-methylsulfanyl-2-[[2-phenyl-4-(1,3-thiazol-2-ylsulfinamoylsulfanyl)benzoyl]amino]butanoate |
| SMILES | COC(=O)[C@H](CCSC)NC(=O)c1ccc(SS(=O)Nc2nccs2)cc1-c1ccccc1 |
| InChI | InChI=1S/C22H23N3O4S4/c1-29-21(27)19(10-12-30-2)24-20(26)17-9-8-16(14-18(17)15-6-4-3-5-7-15)32-33(28)25-22-23-11-13-31-22/h3-9,11,13-14,19H,10,12H2,1-2H3,(H,23,25)(H,24,26)/t19-,33?/m0/s1 |
| InChIKey | QBIIMNFXIJBKMR-LPEGZLAKSA-N |
| XLogP | 4.62 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|