C24H26N4O2S — CID 20624305
N'-(4-methylsulfanyl-1-oxobutan-2-yl)-2-phenyl-4-[(pyridin-2-ylamino)methyl]benzohydrazide (PubChem CID 20624305) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is N'-(4-methylsulfanyl-1-oxobutan-2-yl)-2-phenyl-4-[(pyridin-2-ylamino)methyl]benzohydrazide.
| Compound Name | N'-(4-methylsulfanyl-1-oxobutan-2-yl)-2-phenyl-4-[(pyridin-2-ylamino)methyl]benzohydrazide |
|---|---|
| PubChem CID | 20624305 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N'-(4-methylsulfanyl-1-oxobutan-2-yl)-2-phenyl-4-[(pyridin-2-ylamino)methyl]benzohydrazide |
| SMILES | CSCCC(C=O)NNC(=O)c1ccc(CNc2ccccn2)cc1-c1ccccc1 |
| InChI | InChI=1S/C24H26N4O2S/c1-31-14-12-20(17-29)27-28-24(30)21-11-10-18(16-26-23-9-5-6-13-25-23)15-22(21)19-7-3-2-4-8-19/h2-11,13,15,17,20,27H,12,14,16H2,1H3,(H,25,26)(H,28,30) |
| InChIKey | ONQNRMYKJJSQKV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|