C24H25N3O3S3 — CID 59926820
S-[4-[[[(2R)-4-methylsulfanyl-1-oxobutan-2-yl]amino]carbamoyl]-3-phenylphenyl] N-(thiophen-2-ylmethyl)carbamothioate (PubChem CID 59926820) has the molecular formula C24H25N3O3S3 and a molecular weight of 499.68 g/mol. Its IUPAC name is S-[4-[[[(2R)-4-methylsulfanyl-1-oxobutan-2-yl]amino]carbamoyl]-3-phenylphenyl] N-(thiophen-2-ylmethyl)carbamothioate.
| Compound Name | S-[4-[[[(2R)-4-methylsulfanyl-1-oxobutan-2-yl]amino]carbamoyl]-3-phenylphenyl] N-(thiophen-2-ylmethyl)carbamothioate |
|---|---|
| PubChem CID | 59926820 |
| Molecular Formula | C24H25N3O3S3 |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | S-[4-[[[(2R)-4-methylsulfanyl-1-oxobutan-2-yl]amino]carbamoyl]-3-phenylphenyl] N-(thiophen-2-ylmethyl)carbamothioate |
| SMILES | CSCC[C@H](C=O)NNC(=O)c1ccc(SC(=O)NCc2cccs2)cc1-c1ccccc1 |
| InChI | InChI=1S/C24H25N3O3S3/c1-31-13-11-18(16-28)26-27-23(29)21-10-9-19(14-22(21)17-6-3-2-4-7-17)33-24(30)25-15-20-8-5-12-32-20/h2-10,12,14,16,18,26H,11,13,15H2,1H3,(H,25,30)(H,27,29)/t18-/m1/s1 |
| InChIKey | UANYEXVRUKIPDQ-GOSISDBHSA-N |
| XLogP | 4.97 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|