C11H14N4O2S2 — CID 82226004
4-methylsulfanyl-2-[5-(thiophen-2-ylmethyl)tetrazol-1-yl]butanoic acid (PubChem CID 82226004) has the molecular formula C11H14N4O2S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-methylsulfanyl-2-[5-(thiophen-2-ylmethyl)tetrazol-1-yl]butanoic acid.
| Compound Name | 4-methylsulfanyl-2-[5-(thiophen-2-ylmethyl)tetrazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 82226004 |
| Molecular Formula | C11H14N4O2S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4-methylsulfanyl-2-[5-(thiophen-2-ylmethyl)tetrazol-1-yl]butanoic acid |
| SMILES | CSCCC(C(=O)O)n1nnnc1Cc1cccs1 |
| InChI | InChI=1S/C11H14N4O2S2/c1-18-6-4-9(11(16)17)15-10(12-13-14-15)7-8-3-2-5-19-8/h2-3,5,9H,4,6-7H2,1H3,(H,16,17) |
| InChIKey | BYPKYSWIJQXQRN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |