C11H14N4O2S — CID 82225831
3-methyl-2-(5-thiophen-2-yltetrazol-1-yl)pentanoic acid (PubChem CID 82225831) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 3-methyl-2-(5-thiophen-2-yltetrazol-1-yl)pentanoic acid.
| Compound Name | 3-methyl-2-(5-thiophen-2-yltetrazol-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 82225831 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 3-methyl-2-(5-thiophen-2-yltetrazol-1-yl)pentanoic acid |
| SMILES | CCC(C)C(C(=O)O)n1nnnc1-c1cccs1 |
| InChI | InChI=1S/C11H14N4O2S/c1-3-7(2)9(11(16)17)15-10(12-13-14-15)8-5-4-6-18-8/h4-7,9H,3H2,1-2H3,(H,16,17) |
| InChIKey | DRQVVYQCCLOKGY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |