C14H17ClN4O3 — CID 82225858
2-[5-[(2-chlorophenoxy)methyl]tetrazol-1-yl]-3-methylpentanoic acid (PubChem CID 82225858) has the molecular formula C14H17ClN4O3 and a molecular weight of 324.77 g/mol. Its IUPAC name is 2-[5-[(2-chlorophenoxy)methyl]tetrazol-1-yl]-3-methylpentanoic acid.
| Compound Name | 2-[5-[(2-chlorophenoxy)methyl]tetrazol-1-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 82225858 |
| Molecular Formula | C14H17ClN4O3 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-[5-[(2-chlorophenoxy)methyl]tetrazol-1-yl]-3-methylpentanoic acid |
| SMILES | CCC(C)C(C(=O)O)n1nnnc1COc1ccccc1Cl |
| InChI | InChI=1S/C14H17ClN4O3/c1-3-9(2)13(14(20)21)19-12(16-17-18-19)8-22-11-7-5-4-6-10(11)15/h4-7,9,13H,3,8H2,1-2H3,(H,20,21) |
| InChIKey | STEPRUDCUUPCCE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |