C14H17ClN4O3 — CID 82226178
2-[5-[(2-chlorophenoxy)methyl]tetrazol-1-yl]hexanoic acid (PubChem CID 82226178) has the molecular formula C14H17ClN4O3 and a molecular weight of 324.77 g/mol. Its IUPAC name is 2-[5-[(2-chlorophenoxy)methyl]tetrazol-1-yl]hexanoic acid.
| Compound Name | 2-[5-[(2-chlorophenoxy)methyl]tetrazol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 82226178 |
| Molecular Formula | C14H17ClN4O3 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-[5-[(2-chlorophenoxy)methyl]tetrazol-1-yl]hexanoic acid |
| SMILES | CCCCC(C(=O)O)n1nnnc1COc1ccccc1Cl |
| InChI | InChI=1S/C14H17ClN4O3/c1-2-3-7-11(14(20)21)19-13(16-17-18-19)9-22-12-8-5-4-6-10(12)15/h4-6,8,11H,2-3,7,9H2,1H3,(H,20,21) |
| InChIKey | KZIFAQSBWXSWFZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |