C12H13ClN4O3 — CID 71692586
ethyl 2-[5-[(2-chlorophenoxy)methyl]tetrazol-1-yl]acetate (PubChem CID 71692586) has the molecular formula C12H13ClN4O3 and a molecular weight of 296.71 g/mol. Its IUPAC name is ethyl 2-[5-[(2-chlorophenoxy)methyl]tetrazol-1-yl]acetate.
| Compound Name | ethyl 2-[5-[(2-chlorophenoxy)methyl]tetrazol-1-yl]acetate |
|---|---|
| PubChem CID | 71692586 |
| Molecular Formula | C12H13ClN4O3 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | ethyl 2-[5-[(2-chlorophenoxy)methyl]tetrazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1nnnc1COc1ccccc1Cl |
| InChI | InChI=1S/C12H13ClN4O3/c1-2-19-12(18)7-17-11(14-15-16-17)8-20-10-6-4-3-5-9(10)13/h3-6H,2,7-8H2,1H3 |
| InChIKey | VZBNQIRRCFMMKC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |