C13H14FN3O3 — CID 166241840
ethyl 2-[4-[(2-fluorophenoxy)methyl]triazol-1-yl]acetate (PubChem CID 166241840) has the molecular formula C13H14FN3O3 and a molecular weight of 279.27 g/mol. Its IUPAC name is ethyl 2-[4-[(2-fluorophenoxy)methyl]triazol-1-yl]acetate.
| Compound Name | ethyl 2-[4-[(2-fluorophenoxy)methyl]triazol-1-yl]acetate |
|---|---|
| PubChem CID | 166241840 |
| Molecular Formula | C13H14FN3O3 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | ethyl 2-[4-[(2-fluorophenoxy)methyl]triazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1cc(COc2ccccc2F)nn1 |
| InChI | InChI=1S/C13H14FN3O3/c1-2-19-13(18)8-17-7-10(15-16-17)9-20-12-6-4-3-5-11(12)14/h3-7H,2,8-9H2,1H3 |
| InChIKey | MGBWSVPHADXXBK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |